C21H27N5O — CID 119116530
N-ethyl-N'-[(6-morpholin-4-yl-3-pyridinyl)methyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 119116530) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-ethyl-N'-[(6-morpholin-4-yl-3-pyridinyl)methyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(6-morpholin-4-yl-3-pyridinyl)methyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 119116530 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-ethyl-N'-[(6-morpholin-4-yl-3-pyridinyl)methyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCOCC2)nc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H27N5O/c1-2-22-21(26-10-9-18-5-3-4-6-19(18)26)24-16-17-7-8-20(23-15-17)25-11-13-27-14-12-25/h3-8,15H,2,9-14,16H2,1H3,(H,22,24) |
| InChIKey | JQVOLAPJIXGUCK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|