C21H23NO2 — CID 11110047
1-benzyl-5-butyl-5-hydroxy-4-phenylpyrrol-2-one (PubChem CID 11110047) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-benzyl-5-butyl-5-hydroxy-4-phenylpyrrol-2-one.
| Compound Name | 1-benzyl-5-butyl-5-hydroxy-4-phenylpyrrol-2-one |
|---|---|
| PubChem CID | 11110047 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-benzyl-5-butyl-5-hydroxy-4-phenylpyrrol-2-one |
| SMILES | CCCCC1(O)C(c2ccccc2)=CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-2-3-14-21(24)19(18-12-8-5-9-13-18)15-20(23)22(21)16-17-10-6-4-7-11-17/h4-13,15,24H,2-3,14,16H2,1H3 |
| InChIKey | VFONQELZMQTOPJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |