C16H28O5Si — CID 11110270
(4R,5R)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 11110270) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (4R,5R)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5R)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 11110270 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4R,5R)-5-[1-[tert-butyl(dimethyl)silyl]oxybut-3-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C#CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1C(=O)O |
| InChI | InChI=1S/C16H28O5Si/c1-9-10-11(21-22(7,8)15(2,3)4)12-13(14(17)18)20-16(5,6)19-12/h1,11-13H,10H2,2-8H3,(H,17,18)/t11?,12-,13+/m0/s1 |
| InChIKey | YJZMWADPTFBHOQ-LWNNLKQOSA-N |
| XLogP | 3.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|