C18H32O6Si — CID 139262751
methyl (4S,5R)-5-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypent-4-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 139262751) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypent-4-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypent-4-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 139262751 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | methyl (4S,5R)-5-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypent-4-ynyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | C#C[C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H32O6Si/c1-10-12(19)11-13(24-25(8,9)17(2,3)4)14-15(16(20)21-7)23-18(5,6)22-14/h1,12-15,19H,11H2,2-9H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | UIRMGMOOZDJGHS-QPSCCSFWSA-N |
| XLogP | 2.45 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|