C17H32O7Si — CID 10499788
methyl (2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2-carboxylate (PubChem CID 10499788) has the molecular formula C17H32O7Si and a molecular weight of 376.52 g/mol. Its IUPAC name is methyl (2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2-carboxylate |
|---|---|
| PubChem CID | 10499788 |
| Molecular Formula | C17H32O7Si |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | methyl (2R,3R,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O7Si/c1-16(2,3)25(7,8)24-13-11(18)12(22-14(13)15(19)20-6)10-9-21-17(4,5)23-10/h10-14,18H,9H2,1-8H3/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | ZIKIXEXIGHCKKS-XVIXHAIJSA-N |
| XLogP | 1.83 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|