C15H26O8 — CID 23629194
ethyl (2S,3S)-3-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropanoate (PubChem CID 23629194) has the molecular formula C15H26O8 and a molecular weight of 334.37 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropanoate.
| Compound Name | ethyl (2S,3S)-3-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 23629194 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl (2S,3S)-3-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H26O8/c1-6-19-13(18)10(17)9(16)12-11(22-15(4,5)23-12)8-7-20-14(2,3)21-8/h8-12,16-17H,6-7H2,1-5H3/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | IFQNITCNCNOZTH-IIRVCBMXSA-N |
| XLogP | -0.06 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |