C32H66O9Si3 — CID 10996015
ethyl (4S)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate (PubChem CID 10996015) has the molecular formula C32H66O9Si3 and a molecular weight of 679.13 g/mol. Its IUPAC name is ethyl (4S)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate.
| Compound Name | ethyl (4S)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
|---|---|
| PubChem CID | 10996015 |
| Molecular Formula | C32H66O9Si3 |
| Molecular Weight | 679.13 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | ethyl (4S)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)C[C@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O9Si3/c1-19-36-28(35)23(34)20-22(33)25-27(39-32(11,12)38-25)26(41-44(17,18)31(8,9)10)24(40-43(15,16)30(5,6)7)21-37-42(13,14)29(2,3)4/h22,24-27,33H,19-21H2,1-18H3/t22-,24+,25+,26+,27+/m0/s1 |
| InChIKey | YYQSVVFHPCTYPM-QZAJBKBESA-N |
| XLogP | 7.19 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.13 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|