C19H36O7Si — CID 10621262
ethyl (2R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxyoxane-2-carboxylate (PubChem CID 10621262) has the molecular formula C19H36O7Si and a molecular weight of 404.58 g/mol. Its IUPAC name is ethyl (2R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxyoxane-2-carboxylate.
| Compound Name | ethyl (2R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10621262 |
| Molecular Formula | C19H36O7Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | ethyl (2R,4R,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxyoxane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C19H36O7Si/c1-9-22-17(21)13-10-12(26-27(7,8)18(2,3)4)15(20)16(24-13)14-11-23-19(5,6)25-14/h12-16,20H,9-11H2,1-8H3/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | OJYKXEYTVBUDJW-OXGONZEZSA-N |
| XLogP | 2.61 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|