C11H16ClN3OS2 — CID 111104956
3-[2-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethylsulfanyl]propan-1-ol (PubChem CID 111104956) has the molecular formula C11H16ClN3OS2 and a molecular weight of 305.86 g/mol. Its IUPAC name is 3-[2-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 111104956 |
| Molecular Formula | C11H16ClN3OS2 |
| Molecular Weight | 305.86 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[2-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNCc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C11H16ClN3OS2/c12-10-9(15-3-7-18-11(15)14-10)8-13-2-6-17-5-1-4-16/h3,7,13,16H,1-2,4-6,8H2 |
| InChIKey | DXPFIJNGRIBLQH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|