C12H19N3OS2 — CID 66127925
3-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylpropan-1-ol (PubChem CID 66127925) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 3-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylpropan-1-ol.
| Compound Name | 3-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 66127925 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanylpropan-1-ol |
| SMILES | CCCNCc1c(SCCCO)nc2sccn12 |
| InChI | InChI=1S/C12H19N3OS2/c1-2-4-13-9-10-11(17-7-3-6-16)14-12-15(10)5-8-18-12/h5,8,13,16H,2-4,6-7,9H2,1H3 |
| InChIKey | SLERVPHSSVAOHQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|