C15H17N3S2 — CID 63804515
N-[(6-phenylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine (PubChem CID 63804515) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is N-[(6-phenylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(6-phenylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63804515 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[(6-phenylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1c(Sc2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C15H17N3S2/c1-2-8-16-11-13-14(17-15-18(13)9-10-19-15)20-12-6-4-3-5-7-12/h3-7,9-10,16H,2,8,11H2,1H3 |
| InChIKey | FZBROEHKPFZCQQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|