C15H20N4S2 — CID 43527744
N-methyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 43527744) has the molecular formula C15H20N4S2 and a molecular weight of 320.49 g/mol. Its IUPAC name is N-methyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-methyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 43527744 |
| Molecular Formula | C15H20N4S2 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-methyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CCCNCc1c(N(C)Cc2cccs2)nc2sccn12 |
| InChI | InChI=1S/C15H20N4S2/c1-3-6-16-10-13-14(17-15-19(13)7-9-21-15)18(2)11-12-5-4-8-20-12/h4-5,7-9,16H,3,6,10-11H2,1-2H3 |
| InChIKey | GYKPXHZSGBVXNB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|