C13H15N3S2 — CID 43763585
N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-thiophen-2-ylethanamine (PubChem CID 43763585) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43763585 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-thiophen-2-ylethanamine |
| SMILES | Cc1nc2sccn2c1CNCCc1cccs1 |
| InChI | InChI=1S/C13H15N3S2/c1-10-12(16-6-8-18-13(16)15-10)9-14-5-4-11-3-2-7-17-11/h2-3,6-8,14H,4-5,9H2,1H3 |
| InChIKey | XFQUPXBUSNGVEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|