C10H12N4S — CID 43771524
3-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanenitrile (PubChem CID 43771524) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanenitrile.
| Compound Name | 3-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 43771524 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]propanenitrile |
| SMILES | Cc1nc2sccn2c1CNCCC#N |
| InChI | InChI=1S/C10H12N4S/c1-8-9(7-12-4-2-3-11)14-5-6-15-10(14)13-8/h5-6,12H,2,4,7H2,1H3 |
| InChIKey | QRURLJLVLJLDOJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|