C13H22N4S — CID 43761768
N',N'-diethyl-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 43761768) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is N',N'-diethyl-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 43761768 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N',N'-diethyl-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1c(C)nc2sccn12 |
| InChI | InChI=1S/C13H22N4S/c1-4-16(5-2)7-6-14-10-12-11(3)15-13-17(12)8-9-18-13/h8-9,14H,4-7,10H2,1-3H3 |
| InChIKey | PLMQOOHPZPENTH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|