C15H26N4S — CID 43570377
N-methyl-N-(3-methylbutan-2-yl)-5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 43570377) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is N-methyl-N-(3-methylbutan-2-yl)-5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | N-methyl-N-(3-methylbutan-2-yl)-5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 43570377 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-methyl-N-(3-methylbutan-2-yl)-5-(propylaminomethyl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CCCNCc1c(N(C)C(C)C(C)C)nc2sccn12 |
| InChI | InChI=1S/C15H26N4S/c1-6-7-16-10-13-14(18(5)12(4)11(2)3)17-15-19(13)8-9-20-15/h8-9,11-12,16H,6-7,10H2,1-5H3 |
| InChIKey | FAPHLHMLQHOMHI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|