C11H17N3S2 — CID 63818995
2-(6-butylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)ethanamine (PubChem CID 63818995) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 2-(6-butylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)ethanamine.
| Compound Name | 2-(6-butylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 63818995 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(6-butylsulfanylimidazo[2,1-b][1,3]thiazol-5-yl)ethanamine |
| SMILES | CCCCSc1nc2sccn2c1CCN |
| InChI | InChI=1S/C11H17N3S2/c1-2-3-7-15-10-9(4-5-12)14-6-8-16-11(14)13-10/h6,8H,2-5,7,12H2,1H3 |
| InChIKey | JFGYTDCULNHBGZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|