C16H25N3O4 — CID 111107456
1-(2,2-dimethylpropyl)-1-(3-hydroxypropyl)-3-(2-methyl-3-nitrophenyl)urea (PubChem CID 111107456) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-1-(3-hydroxypropyl)-3-(2-methyl-3-nitrophenyl)urea.
| Compound Name | 1-(2,2-dimethylpropyl)-1-(3-hydroxypropyl)-3-(2-methyl-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 111107456 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-1-(3-hydroxypropyl)-3-(2-methyl-3-nitrophenyl)urea |
| SMILES | Cc1c(NC(=O)N(CCCO)CC(C)(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O4/c1-12-13(7-5-8-14(12)19(22)23)17-15(21)18(9-6-10-20)11-16(2,3)4/h5,7-8,20H,6,9-11H2,1-4H3,(H,17,21) |
| InChIKey | MALUFTJHOKUKKC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|