C20H20F2N2O — CID 111109176
4-fluoro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 111109176) has the molecular formula C20H20F2N2O and a molecular weight of 342.39 g/mol. Its IUPAC name is 4-fluoro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 111109176 |
| Molecular Formula | C20H20F2N2O |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-fluoro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(CN2CCC(C(O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H20F2N2O/c21-18-4-2-15(3-5-18)20(25)16-7-9-24(10-8-16)13-17-11-14(12-23)1-6-19(17)22/h1-6,11,16,20,25H,7-10,13H2 |
| InChIKey | LGFZRDVCZIFFCJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |