C21H24N2O3 — CID 11110952
4-(7-methoxyspiro[3H-1-benzofuran-2,1'-cyclopentane]-4-yl)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one (PubChem CID 11110952) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-(7-methoxyspiro[3H-1-benzofuran-2,1'-cyclopentane]-4-yl)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-(7-methoxyspiro[3H-1-benzofuran-2,1'-cyclopentane]-4-yl)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 11110952 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-(7-methoxyspiro[3H-1-benzofuran-2,1'-cyclopentane]-4-yl)-4a,5,8,8a-tetrahydro-2H-phthalazin-1-one |
| SMILES | COc1ccc(C2=NNC(=O)C3CC=CCC23)c2c1OC1(CCCC1)C2 |
| InChI | InChI=1S/C21H24N2O3/c1-25-17-9-8-14(16-12-21(26-19(16)17)10-4-5-11-21)18-13-6-2-3-7-15(13)20(24)23-22-18/h2-3,8-9,13,15H,4-7,10-12H2,1H3,(H,23,24) |
| InChIKey | NMGSQEBMRHQDOG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|