C21H24BNO4S — CID 174152806
3-[(4R)-2-hydroxyoxaborolan-4-yl]-5-(7-methoxyspiro[3H-1-benzofuran-2,4'-thiane]-4-yl)pyridine (PubChem CID 174152806) has the molecular formula C21H24BNO4S and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-[(4R)-2-hydroxyoxaborolan-4-yl]-5-(7-methoxyspiro[3H-1-benzofuran-2,4'-thiane]-4-yl)pyridine.
| Compound Name | 3-[(4R)-2-hydroxyoxaborolan-4-yl]-5-(7-methoxyspiro[3H-1-benzofuran-2,4'-thiane]-4-yl)pyridine |
|---|---|
| PubChem CID | 174152806 |
| Molecular Formula | C21H24BNO4S |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[(4R)-2-hydroxyoxaborolan-4-yl]-5-(7-methoxyspiro[3H-1-benzofuran-2,4'-thiane]-4-yl)pyridine |
| SMILES | COc1ccc(-c2cncc([C@@H]3COB(O)C3)c2)c2c1OC1(CCSCC1)C2 |
| InChI | InChI=1S/C21H24BNO4S/c1-25-19-3-2-17(18-9-21(27-20(18)19)4-6-28-7-5-21)15-8-14(11-23-12-15)16-10-22(24)26-13-16/h2-3,8,11-12,16,24H,4-7,9-10,13H2,1H3/t16-/m0/s1 |
| InChIKey | IYJZKSBKQIEXBD-INIZCTEOSA-N |
| XLogP | 3.55 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|