C17H21BN2O4 — CID 156778851
2-[(4S)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyrazine (PubChem CID 156778851) has the molecular formula C17H21BN2O4 and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-[(4S)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyrazine.
| Compound Name | 2-[(4S)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyrazine |
|---|---|
| PubChem CID | 156778851 |
| Molecular Formula | C17H21BN2O4 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[(4S)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyrazine |
| SMILES | CCCOc1cc(-c2cncc([C@H]3COB(O)C3)n2)ccc1OC |
| InChI | InChI=1S/C17H21BN2O4/c1-3-6-23-17-7-12(4-5-16(17)22-2)14-9-19-10-15(20-14)13-8-18(21)24-11-13/h4-5,7,9-10,13,21H,3,6,8,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | KMMRUMFLHSCURH-CYBMUJFWSA-N |
| XLogP | 2.54 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|