C20H23BFNO4 — CID 156778896
2-(3-cyclopentyloxy-4-methoxyphenyl)-3-fluoro-6-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine (PubChem CID 156778896) has the molecular formula C20H23BFNO4 and a molecular weight of 371.22 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-fluoro-6-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-fluoro-6-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine |
|---|---|
| PubChem CID | 156778896 |
| Molecular Formula | C20H23BFNO4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-fluoro-6-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine |
| SMILES | COc1ccc(-c2nc([C@@H]3COB(O)C3)ccc2F)cc1OC1CCCC1 |
| InChI | InChI=1S/C20H23BFNO4/c1-25-18-9-6-13(10-19(18)27-15-4-2-3-5-15)20-16(22)7-8-17(23-20)14-11-21(24)26-12-14/h6-10,14-15,24H,2-5,11-12H2,1H3/t14-/m0/s1 |
| InChIKey | WRPUKSPCURFZGN-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|