C16H17BFNO4 — CID 150311789
2-(2-fluoro-3,4-dimethoxyphenyl)-6-(2-hydroxyoxaborolan-4-yl)pyridine (PubChem CID 150311789) has the molecular formula C16H17BFNO4 and a molecular weight of 317.13 g/mol. Its IUPAC name is 2-(2-fluoro-3,4-dimethoxyphenyl)-6-(2-hydroxyoxaborolan-4-yl)pyridine.
| Compound Name | 2-(2-fluoro-3,4-dimethoxyphenyl)-6-(2-hydroxyoxaborolan-4-yl)pyridine |
|---|---|
| PubChem CID | 150311789 |
| Molecular Formula | C16H17BFNO4 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(2-fluoro-3,4-dimethoxyphenyl)-6-(2-hydroxyoxaborolan-4-yl)pyridine |
| SMILES | COc1ccc(-c2cccc(C3COB(O)C3)n2)c(F)c1OC |
| InChI | InChI=1S/C16H17BFNO4/c1-21-14-7-6-11(15(18)16(14)22-2)13-5-3-4-12(19-13)10-8-17(20)23-9-10/h3-7,10,20H,8-9H2,1-2H3 |
| InChIKey | GLTUNHKTJBCFDC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|