C19H22BFO4 — CID 156900438
(4S)-4-[3-(2-fluoro-4-methoxy-3-propoxyphenyl)phenyl]-2-hydroxyoxaborolane (PubChem CID 156900438) has the molecular formula C19H22BFO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is (4S)-4-[3-(2-fluoro-4-methoxy-3-propoxyphenyl)phenyl]-2-hydroxyoxaborolane.
| Compound Name | (4S)-4-[3-(2-fluoro-4-methoxy-3-propoxyphenyl)phenyl]-2-hydroxyoxaborolane |
|---|---|
| PubChem CID | 156900438 |
| Molecular Formula | C19H22BFO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4S)-4-[3-(2-fluoro-4-methoxy-3-propoxyphenyl)phenyl]-2-hydroxyoxaborolane |
| SMILES | CCCOc1c(OC)ccc(-c2cccc([C@H]3COB(O)C3)c2)c1F |
| InChI | InChI=1S/C19H22BFO4/c1-3-9-24-19-17(23-2)8-7-16(18(19)21)14-6-4-5-13(10-14)15-11-20(22)25-12-15/h4-8,10,15,22H,3,9,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | ACSFXANDJFYYLR-OAHLLOKOSA-N |
| XLogP | 3.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|