C18H21BO3S — CID 148635270
4-[3-(3-ethoxy-4-methylsulfanylphenyl)phenyl]-2-hydroxyoxaborolane (PubChem CID 148635270) has the molecular formula C18H21BO3S and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-[3-(3-ethoxy-4-methylsulfanylphenyl)phenyl]-2-hydroxyoxaborolane.
| Compound Name | 4-[3-(3-ethoxy-4-methylsulfanylphenyl)phenyl]-2-hydroxyoxaborolane |
|---|---|
| PubChem CID | 148635270 |
| Molecular Formula | C18H21BO3S |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-[3-(3-ethoxy-4-methylsulfanylphenyl)phenyl]-2-hydroxyoxaborolane |
| SMILES | CCOc1cc(-c2cccc(C3COB(O)C3)c2)ccc1SC |
| InChI | InChI=1S/C18H21BO3S/c1-3-21-17-10-15(7-8-18(17)23-2)13-5-4-6-14(9-13)16-11-19(20)22-12-16/h4-10,16,20H,3,11-12H2,1-2H3 |
| InChIKey | NIYFTEWHPNIZDS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|