C21H25BO4 — CID 156900450
(4R)-4-[3-(3-cyclopentyloxy-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane (PubChem CID 156900450) has the molecular formula C21H25BO4 and a molecular weight of 352.24 g/mol. Its IUPAC name is (4R)-4-[3-(3-cyclopentyloxy-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane.
| Compound Name | (4R)-4-[3-(3-cyclopentyloxy-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane |
|---|---|
| PubChem CID | 156900450 |
| Molecular Formula | C21H25BO4 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (4R)-4-[3-(3-cyclopentyloxy-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane |
| SMILES | COc1ccc(-c2cccc([C@@H]3COB(O)C3)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H25BO4/c1-24-20-10-9-17(12-21(20)26-19-7-2-3-8-19)15-5-4-6-16(11-15)18-13-22(23)25-14-18/h4-6,9-12,18-19,23H,2-3,7-8,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | MMFSZTSULUZFPW-SFHVURJKSA-N |
| XLogP | 4.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|