C18H20BFO4 — CID 156900453
(4R)-4-[3-(3-ethoxy-2-fluoro-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane (PubChem CID 156900453) has the molecular formula C18H20BFO4 and a molecular weight of 330.16 g/mol. Its IUPAC name is (4R)-4-[3-(3-ethoxy-2-fluoro-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane.
| Compound Name | (4R)-4-[3-(3-ethoxy-2-fluoro-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane |
|---|---|
| PubChem CID | 156900453 |
| Molecular Formula | C18H20BFO4 |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (4R)-4-[3-(3-ethoxy-2-fluoro-4-methoxyphenyl)phenyl]-2-hydroxyoxaborolane |
| SMILES | CCOc1c(OC)ccc(-c2cccc([C@@H]3COB(O)C3)c2)c1F |
| InChI | InChI=1S/C18H20BFO4/c1-3-23-18-16(22-2)8-7-15(17(18)20)13-6-4-5-12(9-13)14-10-19(21)24-11-14/h4-9,14,21H,3,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | MLCXEKRIEPKKHB-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|