C18H22BNO4 — CID 149472731
3-(3-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]-2-methylpyridine (PubChem CID 149472731) has the molecular formula C18H22BNO4 and a molecular weight of 327.19 g/mol. Its IUPAC name is 3-(3-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]-2-methylpyridine.
| Compound Name | 3-(3-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]-2-methylpyridine |
|---|---|
| PubChem CID | 149472731 |
| Molecular Formula | C18H22BNO4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-(3-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]-2-methylpyridine |
| SMILES | CCOc1cc(-c2cc([C@@H]3COB(O)C3)cnc2C)ccc1OC |
| InChI | InChI=1S/C18H22BNO4/c1-4-23-18-8-13(5-6-17(18)22-3)16-7-14(10-20-12(16)2)15-9-19(21)24-11-15/h5-8,10,15,21H,4,9,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | ZBRGRDVCYGRAEF-HNNXBMFYSA-N |
| XLogP | 3.06 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|