C15H19BN2O4S — CID 150906143
3-(2-hydroxyoxaborolan-4-yl)-5-(4-methoxy-3-propoxyphenyl)-1,2,4-thiadiazole (PubChem CID 150906143) has the molecular formula C15H19BN2O4S and a molecular weight of 334.21 g/mol. Its IUPAC name is 3-(2-hydroxyoxaborolan-4-yl)-5-(4-methoxy-3-propoxyphenyl)-1,2,4-thiadiazole.
| Compound Name | 3-(2-hydroxyoxaborolan-4-yl)-5-(4-methoxy-3-propoxyphenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 150906143 |
| Molecular Formula | C15H19BN2O4S |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-(2-hydroxyoxaborolan-4-yl)-5-(4-methoxy-3-propoxyphenyl)-1,2,4-thiadiazole |
| SMILES | CCCOc1cc(-c2nc(C3COB(O)C3)ns2)ccc1OC |
| InChI | InChI=1S/C15H19BN2O4S/c1-3-6-21-13-7-10(4-5-12(13)20-2)15-17-14(18-23-15)11-8-16(19)22-9-11/h4-5,7,11,19H,3,6,8-9H2,1-2H3 |
| InChIKey | LBADOWKZXSXFPE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|