C19H24BNO4 — CID 156778789
2-[(3R,4R)-2-hydroxy-3-methyloxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyridine (PubChem CID 156778789) has the molecular formula C19H24BNO4 and a molecular weight of 341.22 g/mol. Its IUPAC name is 2-[(3R,4R)-2-hydroxy-3-methyloxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyridine.
| Compound Name | 2-[(3R,4R)-2-hydroxy-3-methyloxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyridine |
|---|---|
| PubChem CID | 156778789 |
| Molecular Formula | C19H24BNO4 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[(3R,4R)-2-hydroxy-3-methyloxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)pyridine |
| SMILES | CCCOc1cc(-c2cccc([C@@H]3COB(O)[C@@H]3C)n2)ccc1OC |
| InChI | InChI=1S/C19H24BNO4/c1-4-10-24-19-11-14(8-9-18(19)23-3)16-6-5-7-17(21-16)15-12-25-20(22)13(15)2/h5-9,11,13,15,22H,4,10,12H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | XDKYSAPKSNEVFP-UKRRQHHQSA-N |
| XLogP | 3.53 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|