C18H23BNO5- — CID 153474628
3-[(4R)-2,2-dihydroxy-1-oxa-2-boranuidacyclopent-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine (PubChem CID 153474628) has the molecular formula C18H23BNO5- and a molecular weight of 344.20 g/mol. Its IUPAC name is 3-[(4R)-2,2-dihydroxy-1-oxa-2-boranuidacyclopent-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine.
| Compound Name | 3-[(4R)-2,2-dihydroxy-1-oxa-2-boranuidacyclopent-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine |
|---|---|
| PubChem CID | 153474628 |
| Molecular Formula | C18H23BNO5- |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[(4R)-2,2-dihydroxy-1-oxa-2-boranuidacyclopent-4-yl]-5-(4-methoxy-3-propoxyphenyl)pyridine |
| SMILES | CCCOc1cc(-c2cncc([C@@H]3CO[B-](O)(O)C3)c2)ccc1OC |
| InChI | InChI=1S/C18H23BNO5/c1-3-6-24-18-8-13(4-5-17(18)23-2)14-7-15(11-20-10-14)16-9-19(21,22)25-12-16/h4-5,7-8,10-11,16,21-22H,3,6,9,12H2,1-2H3/q-1/t16-/m0/s1 |
| InChIKey | VIUHVEXXCVXVCL-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|