C31H48BNO5Si — CID 151087109
tert-butyl-[2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoxy]-dimethylsilane (PubChem CID 151087109) has the molecular formula C31H48BNO5Si and a molecular weight of 553.63 g/mol. Its IUPAC name is tert-butyl-[2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 151087109 |
| Molecular Formula | C31H48BNO5Si |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | tert-butyl-[2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoxy]-dimethylsilane |
| SMILES | CCCOc1cc(-c2cncc(C(CO[Si](C)(C)C(C)(C)C)=C(C)B3OC(C)(C)C(C)(C)O3)c2)ccc1OC |
| InChI | InChI=1S/C31H48BNO5Si/c1-13-16-35-28-18-23(14-15-27(28)34-10)24-17-25(20-33-19-24)26(21-36-39(11,12)29(3,4)5)22(2)32-37-30(6,7)31(8,9)38-32/h14-15,17-20H,13,16,21H2,1-12H3 |
| InChIKey | MLINHRFIXKATHD-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|