C24H34BrNO3Si — CID 149129687
[(Z)-3-bromo-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]prop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 149129687) has the molecular formula C24H34BrNO3Si and a molecular weight of 492.53 g/mol. Its IUPAC name is [(Z)-3-bromo-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]prop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(Z)-3-bromo-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]prop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 149129687 |
| Molecular Formula | C24H34BrNO3Si |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [(Z)-3-bromo-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]prop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCOc1cc(-c2cncc(/C(=C/Br)CO[Si](C)(C)C(C)(C)C)c2)ccc1OC |
| InChI | InChI=1S/C24H34BrNO3Si/c1-8-11-28-23-13-18(9-10-22(23)27-5)19-12-20(16-26-15-19)21(14-25)17-29-30(6,7)24(2,3)4/h9-10,12-16H,8,11,17H2,1-7H3/b21-14+ |
| InChIKey | RCDKWQYLRYQPDK-KGENOOAVSA-N |
| XLogP | 7.30 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|