C18H24B2NO6 — CID 175155956
CID 175155956 (PubChem CID 175155956) has the molecular formula C18H24B2NO6 and a molecular weight of 372.02 g/mol.
| Compound Name | CID 175155956 |
|---|---|
| PubChem CID | 175155956 |
| Molecular Formula | C18H24B2NO6 |
| Molecular Weight | 372.02 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | — |
| SMILES | CCCOc1cc(-c2cncc(C(CO)CB(O)O[B]O)c2)ccc1OC |
| InChI | InChI=1S/C18H24B2NO6/c1-3-6-26-18-8-13(4-5-17(18)25-2)14-7-15(11-21-10-14)16(12-22)9-20(24)27-19-23/h4-5,7-8,10-11,16,22-24H,3,6,9,12H2,1-2H3 |
| InChIKey | JBISEEXAFYELPG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.02 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|