C20H25NO5 — CID 146460679
[3-hydroxy-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]propyl] acetate (PubChem CID 146460679) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is [3-hydroxy-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]propyl] acetate.
| Compound Name | [3-hydroxy-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]propyl] acetate |
|---|---|
| PubChem CID | 146460679 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [3-hydroxy-2-[5-(4-methoxy-3-propoxyphenyl)-3-pyridinyl]propyl] acetate |
| SMILES | CCCOc1cc(-c2cncc(C(CO)COC(C)=O)c2)ccc1OC |
| InChI | InChI=1S/C20H25NO5/c1-4-7-25-20-9-15(5-6-19(20)24-3)16-8-17(11-21-10-16)18(12-22)13-26-14(2)23/h5-6,8-11,18,22H,4,7,12-13H2,1-3H3 |
| InChIKey | GOSHFXOIAMLRJU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |