C19H18N2O4 — CID 42845914
5-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 42845914) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42845914 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-(furan-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(-c2cncc(C(=O)NCc3ccco3)c2)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-23-17-6-5-13(9-18(17)24-2)14-8-15(11-20-10-14)19(22)21-12-16-4-3-7-25-16/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | JEIYKRHLPUUUCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |