C19H24BNO5 — CID 156778870
[4-[(4R)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)-2-pyridinyl]methanol (PubChem CID 156778870) has the molecular formula C19H24BNO5 and a molecular weight of 357.22 g/mol. Its IUPAC name is [4-[(4R)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)-2-pyridinyl]methanol.
| Compound Name | [4-[(4R)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 156778870 |
| Molecular Formula | C19H24BNO5 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [4-[(4R)-2-hydroxyoxaborolan-4-yl]-6-(4-methoxy-3-propoxyphenyl)-2-pyridinyl]methanol |
| SMILES | CCCOc1cc(-c2cc([C@@H]3COB(O)C3)cc(CO)n2)ccc1OC |
| InChI | InChI=1S/C19H24BNO5/c1-3-6-25-19-9-13(4-5-18(19)24-2)17-8-14(7-16(11-22)21-17)15-10-20(23)26-12-15/h4-5,7-9,15,22-23H,3,6,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | DVDIJPCBMWHUJB-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|