C19H21BN2O4 — CID 156778810
6-[6-[(4S)-2-hydroxyoxaborolan-4-yl]-2-pyridinyl]-3-methoxy-2-propoxybenzonitrile (PubChem CID 156778810) has the molecular formula C19H21BN2O4 and a molecular weight of 352.20 g/mol. Its IUPAC name is 6-[6-[(4S)-2-hydroxyoxaborolan-4-yl]-2-pyridinyl]-3-methoxy-2-propoxybenzonitrile.
| Compound Name | 6-[6-[(4S)-2-hydroxyoxaborolan-4-yl]-2-pyridinyl]-3-methoxy-2-propoxybenzonitrile |
|---|---|
| PubChem CID | 156778810 |
| Molecular Formula | C19H21BN2O4 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 6-[6-[(4S)-2-hydroxyoxaborolan-4-yl]-2-pyridinyl]-3-methoxy-2-propoxybenzonitrile |
| SMILES | CCCOc1c(OC)ccc(-c2cccc([C@H]3COB(O)C3)n2)c1C#N |
| InChI | InChI=1S/C19H21BN2O4/c1-3-9-25-19-15(11-21)14(7-8-18(19)24-2)17-6-4-5-16(22-17)13-10-20(23)26-12-13/h4-8,13,23H,3,9-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | YSUVMWFOYHCPQB-CYBMUJFWSA-N |
| XLogP | 3.01 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|