C16H21BN2O4 — CID 150291103
3-(2-hydroxyoxaborolan-4-yl)-1-(4-methoxy-3-propoxyphenyl)pyrazole (PubChem CID 150291103) has the molecular formula C16H21BN2O4 and a molecular weight of 316.17 g/mol. Its IUPAC name is 3-(2-hydroxyoxaborolan-4-yl)-1-(4-methoxy-3-propoxyphenyl)pyrazole.
| Compound Name | 3-(2-hydroxyoxaborolan-4-yl)-1-(4-methoxy-3-propoxyphenyl)pyrazole |
|---|---|
| PubChem CID | 150291103 |
| Molecular Formula | C16H21BN2O4 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-(2-hydroxyoxaborolan-4-yl)-1-(4-methoxy-3-propoxyphenyl)pyrazole |
| SMILES | CCCOc1cc(-n2ccc(C3COB(O)C3)n2)ccc1OC |
| InChI | InChI=1S/C16H21BN2O4/c1-3-8-22-16-9-13(4-5-15(16)21-2)19-7-6-14(18-19)12-10-17(20)23-11-12/h4-7,9,12,20H,3,8,10-11H2,1-2H3 |
| InChIKey | GHPKSQCKGHRBGJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|