C17H18BF2NO4 — CID 156778802
3-(3-ethoxy-2,6-difluoro-4-methoxyphenyl)-5-[(4S)-2-hydroxyoxaborolan-4-yl]pyridine (PubChem CID 156778802) has the molecular formula C17H18BF2NO4 and a molecular weight of 349.14 g/mol. Its IUPAC name is 3-(3-ethoxy-2,6-difluoro-4-methoxyphenyl)-5-[(4S)-2-hydroxyoxaborolan-4-yl]pyridine.
| Compound Name | 3-(3-ethoxy-2,6-difluoro-4-methoxyphenyl)-5-[(4S)-2-hydroxyoxaborolan-4-yl]pyridine |
|---|---|
| PubChem CID | 156778802 |
| Molecular Formula | C17H18BF2NO4 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-(3-ethoxy-2,6-difluoro-4-methoxyphenyl)-5-[(4S)-2-hydroxyoxaborolan-4-yl]pyridine |
| SMILES | CCOc1c(OC)cc(F)c(-c2cncc([C@H]3COB(O)C3)c2)c1F |
| InChI | InChI=1S/C17H18BF2NO4/c1-3-24-17-14(23-2)5-13(19)15(16(17)20)11-4-10(7-21-8-11)12-6-18(22)25-9-12/h4-5,7-8,12,22H,3,6,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | OMKOHILICUZYQC-GFCCVEGCSA-N |
| XLogP | 3.03 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|