C22H26BNO4 — CID 174152763
3-(2-hydroxyoxaborolan-4-yl)-5-(8-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-5-yl)pyridine (PubChem CID 174152763) has the molecular formula C22H26BNO4 and a molecular weight of 379.27 g/mol. Its IUPAC name is 3-(2-hydroxyoxaborolan-4-yl)-5-(8-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-5-yl)pyridine.
| Compound Name | 3-(2-hydroxyoxaborolan-4-yl)-5-(8-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-5-yl)pyridine |
|---|---|
| PubChem CID | 174152763 |
| Molecular Formula | C22H26BNO4 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-(2-hydroxyoxaborolan-4-yl)-5-(8-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-5-yl)pyridine |
| SMILES | COc1ccc(-c2cncc(C3COB(O)C3)c2)c2c1OC1(CCCC1)CC2 |
| InChI | InChI=1S/C22H26BNO4/c1-26-20-5-4-18(19-6-9-22(28-21(19)20)7-2-3-8-22)16-10-15(12-24-13-16)17-11-23(25)27-14-17/h4-5,10,12-13,17,25H,2-3,6-9,11,14H2,1H3 |
| InChIKey | DTSYFXPDHOOYHJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|