C20H24BNO4 — CID 174152760
3-(2-ethyl-8-methoxy-3,4-dihydro-2H-chromen-5-yl)-5-(2-hydroxyoxaborolan-4-yl)pyridine (PubChem CID 174152760) has the molecular formula C20H24BNO4 and a molecular weight of 353.23 g/mol. Its IUPAC name is 3-(2-ethyl-8-methoxy-3,4-dihydro-2H-chromen-5-yl)-5-(2-hydroxyoxaborolan-4-yl)pyridine.
| Compound Name | 3-(2-ethyl-8-methoxy-3,4-dihydro-2H-chromen-5-yl)-5-(2-hydroxyoxaborolan-4-yl)pyridine |
|---|---|
| PubChem CID | 174152760 |
| Molecular Formula | C20H24BNO4 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-(2-ethyl-8-methoxy-3,4-dihydro-2H-chromen-5-yl)-5-(2-hydroxyoxaborolan-4-yl)pyridine |
| SMILES | CCC1CCc2c(-c3cncc(C4COB(O)C4)c3)ccc(OC)c2O1 |
| InChI | InChI=1S/C20H24BNO4/c1-3-16-4-5-18-17(6-7-19(24-2)20(18)26-16)14-8-13(10-22-11-14)15-9-21(23)25-12-15/h6-8,10-11,15-16,23H,3-5,9,12H2,1-2H3 |
| InChIKey | RZCMUCGGUMUDGD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|