C17H19BClNO4 — CID 156778759
3-(3-chloro-5-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine (PubChem CID 156778759) has the molecular formula C17H19BClNO4 and a molecular weight of 347.61 g/mol. Its IUPAC name is 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine.
| Compound Name | 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine |
|---|---|
| PubChem CID | 156778759 |
| Molecular Formula | C17H19BClNO4 |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-(3-chloro-5-ethoxy-4-methoxyphenyl)-5-[(4R)-2-hydroxyoxaborolan-4-yl]pyridine |
| SMILES | CCOc1cc(-c2cncc([C@@H]3COB(O)C3)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C17H19BClNO4/c1-3-23-16-6-11(5-15(19)17(16)22-2)12-4-13(9-20-8-12)14-7-18(21)24-10-14/h4-6,8-9,14,21H,3,7,10H2,1-2H3/t14-/m0/s1 |
| InChIKey | FSNVCWWCNHXEPX-AWEZNQCLSA-N |
| XLogP | 3.40 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|