C18H19BN2O4 — CID 156778893
3-ethoxy-5-[5-[(4R)-2-hydroxyoxaborolan-4-yl]-3-pyridinyl]-2-methoxybenzonitrile (PubChem CID 156778893) has the molecular formula C18H19BN2O4 and a molecular weight of 338.17 g/mol. Its IUPAC name is 3-ethoxy-5-[5-[(4R)-2-hydroxyoxaborolan-4-yl]-3-pyridinyl]-2-methoxybenzonitrile.
| Compound Name | 3-ethoxy-5-[5-[(4R)-2-hydroxyoxaborolan-4-yl]-3-pyridinyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 156778893 |
| Molecular Formula | C18H19BN2O4 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-ethoxy-5-[5-[(4R)-2-hydroxyoxaborolan-4-yl]-3-pyridinyl]-2-methoxybenzonitrile |
| SMILES | CCOc1cc(-c2cncc([C@@H]3COB(O)C3)c2)cc(C#N)c1OC |
| InChI | InChI=1S/C18H19BN2O4/c1-3-24-17-6-12(4-13(8-20)18(17)23-2)14-5-15(10-21-9-14)16-7-19(22)25-11-16/h4-6,9-10,16,22H,3,7,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | LJBLFYCVUYFLDK-INIZCTEOSA-N |
| XLogP | 2.62 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|