C9H9BrN2O6S — CID 11110967
(2R)-2-amino-3-(4-bromo-2-nitrophenyl)sulfonylpropanoic acid (PubChem CID 11110967) has the molecular formula C9H9BrN2O6S and a molecular weight of 353.15 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-bromo-2-nitrophenyl)sulfonylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(4-bromo-2-nitrophenyl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 11110967 |
| Molecular Formula | C9H9BrN2O6S |
| Molecular Weight | 353.15 g/mol |
| Exact Mass | 351.94 |
| IUPAC Name | (2R)-2-amino-3-(4-bromo-2-nitrophenyl)sulfonylpropanoic acid |
| SMILES | N[C@@H](CS(=O)(=O)c1ccc(Br)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H9BrN2O6S/c10-5-1-2-8(7(3-5)12(15)16)19(17,18)4-6(11)9(13)14/h1-3,6H,4,11H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | HYQPNOWQOCPWQV-LURJTMIESA-N |
| XLogP | 0.54 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|