C18H27NO6 — CID 11110978
dimethyl 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridin-5-yl]prop-2-enyl]propanedioate (PubChem CID 11110978) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridin-5-yl]prop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridin-5-yl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 11110978 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | dimethyl 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-pyridin-5-yl]prop-2-enyl]propanedioate |
| SMILES | C=C(CC(C(=O)OC)C(=O)OC)C1=CN(C(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C18H27NO6/c1-12(10-14(15(20)23-5)16(21)24-6)13-8-7-9-19(11-13)17(22)25-18(2,3)4/h11,14H,1,7-10H2,2-6H3 |
| InChIKey | DUJVDVDBKHOOBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|