C11H14ClF3N2O — CID 111109913
3-[(2-chloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol (PubChem CID 111109913) has the molecular formula C11H14ClF3N2O and a molecular weight of 282.69 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol.
| Compound Name | 3-[(2-chloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 111109913 |
| Molecular Formula | C11H14ClF3N2O |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)methyl-(2,2,2-trifluoroethyl)amino]propan-1-ol |
| SMILES | OCCCN(Cc1ccnc(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C11H14ClF3N2O/c12-10-6-9(2-3-16-10)7-17(4-1-5-18)8-11(13,14)15/h2-3,6,18H,1,4-5,7-8H2 |
| InChIKey | HFBZOAHTANPMIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|