C21H25NO4 — CID 11111036
2-O-benzyl 11-O-methyl (1S,3S,5R,7R,8R,11S)-5-methyl-2-azatricyclo[5.3.1.03,8]undec-9-ene-2,11-dicarboxylate (PubChem CID 11111036) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-O-benzyl 11-O-methyl (1S,3S,5R,7R,8R,11S)-5-methyl-2-azatricyclo[5.3.1.03,8]undec-9-ene-2,11-dicarboxylate.
| Compound Name | 2-O-benzyl 11-O-methyl (1S,3S,5R,7R,8R,11S)-5-methyl-2-azatricyclo[5.3.1.03,8]undec-9-ene-2,11-dicarboxylate |
|---|---|
| PubChem CID | 11111036 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-O-benzyl 11-O-methyl (1S,3S,5R,7R,8R,11S)-5-methyl-2-azatricyclo[5.3.1.03,8]undec-9-ene-2,11-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2C[C@@H](C)C[C@H]3[C@@H]2C=C[C@@H]1N3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25NO4/c1-13-10-16-15-8-9-17(19(16)20(23)25-2)22(18(15)11-13)21(24)26-12-14-6-4-3-5-7-14/h3-9,13,15-19H,10-12H2,1-2H3/t13-,15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | UZLFZOCDEZUBAH-IGERKEGBSA-N |
| XLogP | 3.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|