C17H17NO5 — CID 11381482
8-O-benzyl 2-O-methyl (1R,5R)-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-2,8-dicarboxylate (PubChem CID 11381482) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is 8-O-benzyl 2-O-methyl (1R,5R)-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-2,8-dicarboxylate.
| Compound Name | 8-O-benzyl 2-O-methyl (1R,5R)-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 11381482 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 8-O-benzyl 2-O-methyl (1R,5R)-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-2,8-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@H]2C=C[C@H]1N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c1-22-16(20)15-13-8-7-12(9-14(15)19)18(13)17(21)23-10-11-5-3-2-4-6-11/h2-8,12-13,15H,9-10H2,1H3/t12-,13+,15?/m0/s1 |
| InChIKey | IFRWWMPRYNBQKF-IKCIUXDWSA-N |
| XLogP | 1.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|